C25H23FN2O5S — CID 54652412
[(1R,2aS,8bS)-2-(1,3-benzodioxol-5-ylmethyl)-4-(4-fluorophenyl)sulfonyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-1-yl]methanol (PubChem CID 54652412) has the molecular formula C25H23FN2O5S and a molecular weight of 482.53 g/mol. Its IUPAC name is [(1R,2aS,8bS)-2-(1,3-benzodioxol-5-ylmethyl)-4-(4-fluorophenyl)sulfonyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-1-yl]methanol.
| Compound Name | [(1R,2aS,8bS)-2-(1,3-benzodioxol-5-ylmethyl)-4-(4-fluorophenyl)sulfonyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-1-yl]methanol |
|---|---|
| PubChem CID | 54652412 |
| Molecular Formula | C25H23FN2O5S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [(1R,2aS,8bS)-2-(1,3-benzodioxol-5-ylmethyl)-4-(4-fluorophenyl)sulfonyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-1-yl]methanol |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1C[C@@H]2[C@H](c3ccccc31)[C@H](CO)N2Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H23FN2O5S/c26-17-6-8-18(9-7-17)34(30,31)28-13-21-25(19-3-1-2-4-20(19)28)22(14-29)27(21)12-16-5-10-23-24(11-16)33-15-32-23/h1-11,21-22,25,29H,12-15H2/t21-,22+,25+/m1/s1 |
| InChIKey | LVICBAVDXUVLQS-SLSDLSHTSA-N |
| XLogP | 3.09 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |