C14H28O2 — CID 546530
4,6-bis(2,2-dimethylpropyl)-1,3-dioxane (PubChem CID 546530) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 4,6-bis(2,2-dimethylpropyl)-1,3-dioxane.
| Compound Name | 4,6-bis(2,2-dimethylpropyl)-1,3-dioxane |
|---|---|
| PubChem CID | 546530 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 4,6-bis(2,2-dimethylpropyl)-1,3-dioxane |
| SMILES | CC(C)(C)CC1CC(CC(C)(C)C)OCO1 |
| InChI | InChI=1S/C14H28O2/c1-13(2,3)8-11-7-12(16-10-15-11)9-14(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | JXADAECIMDGVBI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |