C22H23FN2O7S — CID 54654630
2-[(2R,4aR,12aR)-8-[(3-fluorophenyl)sulfonylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid (PubChem CID 54654630) has the molecular formula C22H23FN2O7S and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-[(2R,4aR,12aR)-8-[(3-fluorophenyl)sulfonylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid.
| Compound Name | 2-[(2R,4aR,12aR)-8-[(3-fluorophenyl)sulfonylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid |
|---|---|
| PubChem CID | 54654630 |
| Molecular Formula | C22H23FN2O7S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-[(2R,4aR,12aR)-8-[(3-fluorophenyl)sulfonylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid |
| SMILES | CN1C(=O)c2cc(NS(=O)(=O)c3cccc(F)c3)ccc2OC[C@@H]2O[C@@H](CC(=O)O)CC[C@H]21 |
| InChI | InChI=1S/C22H23FN2O7S/c1-25-18-7-6-15(11-21(26)27)32-20(18)12-31-19-8-5-14(10-17(19)22(25)28)24-33(29,30)16-4-2-3-13(23)9-16/h2-5,8-10,15,18,20,24H,6-7,11-12H2,1H3,(H,26,27)/t15-,18-,20+/m1/s1 |
| InChIKey | BDCSYBKHYWASFD-ZTNFWEORSA-N |
| XLogP | 2.48 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |