C21H22N2O6S — CID 54655132
2-[(2R,4aR,12aS)-5-methyl-6-oxo-8-(thiophene-2-carbonylamino)-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid (PubChem CID 54655132) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is 2-[(2R,4aR,12aS)-5-methyl-6-oxo-8-(thiophene-2-carbonylamino)-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid.
| Compound Name | 2-[(2R,4aR,12aS)-5-methyl-6-oxo-8-(thiophene-2-carbonylamino)-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid |
|---|---|
| PubChem CID | 54655132 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-[(2R,4aR,12aS)-5-methyl-6-oxo-8-(thiophene-2-carbonylamino)-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid |
| SMILES | CN1C(=O)c2cc(NC(=O)c3cccs3)ccc2OC[C@H]2O[C@@H](CC(=O)O)CC[C@H]21 |
| InChI | InChI=1S/C21H22N2O6S/c1-23-15-6-5-13(10-19(24)25)29-17(15)11-28-16-7-4-12(9-14(16)21(23)27)22-20(26)18-3-2-8-30-18/h2-4,7-9,13,15,17H,5-6,10-11H2,1H3,(H,22,26)(H,24,25)/t13-,15-,17-/m1/s1 |
| InChIKey | FHKFRFOBLHJQGZ-FRFSOERESA-N |
| XLogP | 2.86 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |