C25H35N3O5 — CID 54655418
N-[(2S,4aR,12aS)-2-[2-(cyclopentylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide (PubChem CID 54655418) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is N-[(2S,4aR,12aS)-2-[2-(cyclopentylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide.
| Compound Name | N-[(2S,4aR,12aS)-2-[2-(cyclopentylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide |
|---|---|
| PubChem CID | 54655418 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N-[(2S,4aR,12aS)-2-[2-(cyclopentylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)C(=O)N(C)[C@@H]1CC[C@@H](CC(=O)NC3CCCC3)O[C@@H]1CO2 |
| InChI | InChI=1S/C25H35N3O5/c1-3-6-23(29)27-17-9-12-21-19(13-17)25(31)28(2)20-11-10-18(33-22(20)15-32-21)14-24(30)26-16-7-4-5-8-16/h9,12-13,16,18,20,22H,3-8,10-11,14-15H2,1-2H3,(H,26,30)(H,27,29)/t18-,20+,22+/m0/s1 |
| InChIKey | LQKUFEFGQNIODA-CZTZKLFOSA-N |
| XLogP | 3.25 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |