C19H27N3O6S — CID 54655539
2-[(2S,4aS,12aR)-8-(ethylsulfonylamino)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-methylacetamide (PubChem CID 54655539) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[(2S,4aS,12aR)-8-(ethylsulfonylamino)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-methylacetamide.
| Compound Name | 2-[(2S,4aS,12aR)-8-(ethylsulfonylamino)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 54655539 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[(2S,4aS,12aR)-8-(ethylsulfonylamino)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-methylacetamide |
| SMILES | CCS(=O)(=O)Nc1ccc2c(c1)C(=O)N(C)[C@H]1CC[C@@H](CC(=O)NC)O[C@H]1CO2 |
| InChI | InChI=1S/C19H27N3O6S/c1-4-29(25,26)21-12-5-8-16-14(9-12)19(24)22(3)15-7-6-13(10-18(23)20-2)28-17(15)11-27-16/h5,8-9,13,15,17,21H,4,6-7,10-11H2,1-3H3,(H,20,23)/t13-,15-,17-/m0/s1 |
| InChIKey | MWUBPCAJVAERQF-QRTARXTBSA-N |
| XLogP | 0.96 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |