C16H19NO3 — CID 5465575
[(14Z)-14-hydroxyimino-1-tricyclo[6.6.0.02,7]tetradeca-2,4,6-trienyl] acetate (PubChem CID 5465575) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is [(14Z)-14-hydroxyimino-1-tricyclo[6.6.0.02,7]tetradeca-2,4,6-trienyl] acetate.
| Compound Name | [(14Z)-14-hydroxyimino-1-tricyclo[6.6.0.02,7]tetradeca-2,4,6-trienyl] acetate |
|---|---|
| PubChem CID | 5465575 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | [(14Z)-14-hydroxyimino-1-tricyclo[6.6.0.02,7]tetradeca-2,4,6-trienyl] acetate |
| SMILES | CC(=O)OC12/C(=N\O)CCCCCC1c1ccccc12 |
| InChI | InChI=1S/C16H19NO3/c1-11(18)20-16-13(12-7-5-6-9-14(12)16)8-3-2-4-10-15(16)17-19/h5-7,9,13,19H,2-4,8,10H2,1H3/b17-15- |
| InChIKey | QHNXIXKNGVLYPZ-ICFOKQHNSA-N |
| XLogP | 3.34 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|