C19H25NO3 — CID 5465577
[(14Z)-14-hydroxyimino-1-tricyclo[6.6.0.02,7]tetradeca-2,4,6-trienyl] 2,2-dimethylpropanoate (PubChem CID 5465577) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is [(14Z)-14-hydroxyimino-1-tricyclo[6.6.0.02,7]tetradeca-2,4,6-trienyl] 2,2-dimethylpropanoate.
| Compound Name | [(14Z)-14-hydroxyimino-1-tricyclo[6.6.0.02,7]tetradeca-2,4,6-trienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 5465577 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [(14Z)-14-hydroxyimino-1-tricyclo[6.6.0.02,7]tetradeca-2,4,6-trienyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC12/C(=N\O)CCCCCC1c1ccccc12 |
| InChI | InChI=1S/C19H25NO3/c1-18(2,3)17(21)23-19-14(13-9-7-8-11-15(13)19)10-5-4-6-12-16(19)20-22/h7-9,11,14,22H,4-6,10,12H2,1-3H3/b20-16- |
| InChIKey | FFIHQHHTIKBKEV-SILNSSARSA-N |
| XLogP | 4.36 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|