C23H24ClN3O6 — CID 54655812
2-[(2R,4aS,12aS)-8-[(2-chlorophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid (PubChem CID 54655812) has the molecular formula C23H24ClN3O6 and a molecular weight of 473.91 g/mol. Its IUPAC name is 2-[(2R,4aS,12aS)-8-[(2-chlorophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid.
| Compound Name | 2-[(2R,4aS,12aS)-8-[(2-chlorophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid |
|---|---|
| PubChem CID | 54655812 |
| Molecular Formula | C23H24ClN3O6 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 2-[(2R,4aS,12aS)-8-[(2-chlorophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetic acid |
| SMILES | CN1C(=O)c2cc(NC(=O)Nc3ccccc3Cl)ccc2OC[C@H]2O[C@@H](CC(=O)O)CC[C@@H]21 |
| InChI | InChI=1S/C23H24ClN3O6/c1-27-18-8-7-14(11-21(28)29)33-20(18)12-32-19-9-6-13(10-15(19)22(27)30)25-23(31)26-17-5-3-2-4-16(17)24/h2-6,9-10,14,18,20H,7-8,11-12H2,1H3,(H,28,29)(H2,25,26,31)/t14-,18+,20-/m1/s1 |
| InChIKey | OXAKUXNRYZIRLE-HEFCMCLBSA-N |
| XLogP | 3.84 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |