About (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol
(3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol (PubChem CID 5465599) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol.
Molecular Properties
| Compound Name | (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol |
| PubChem CID | 5465599 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol |
| SMILES | CC1(O)/C(=N\O)CC2CC1C2(C)C |
| InChI | InChI=1S/C10H17NO2/c1-9(2)6-4-7(9)10(3,12)8(5-6)11-13/h6-7,12-13H,4-5H2,1-3H3/b11-8- |
| InChIKey | MFPCIFGOPFVBDU-FLIBITNWSA-N |
| XLogP | 1.63 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol?
The IUPAC name of (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol (CID 5465599) is (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol.
What is the SMILES notation for (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol?
The canonical SMILES for (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol is CC1(O)/C(=N\O)CC2CC1C2(C)C.
What is the InChIKey of (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol?
The InChIKey is MFPCIFGOPFVBDU-FLIBITNWSA-N. The full InChI is InChI=1S/C10H17NO2/c1-9(2)6-4-7(9)10(3,12)8(5-6)11-13/h6-7,12-13H,4-5H2,1-3H3/b11-8-.
What are the key properties of (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol?
(3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol has a molecular weight of 183.25 g/mol, XLogP of 1.63, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-hydroxyimino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol is sourced from PubChem (CID 5465599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).