C40H46N6O2 — CID 5465783
12,24-dibutyl-7-N,29-N-dimethoxy-2,5,31,34-tetrazaoctacyclo[16.16.0.03,16.04,13.06,11.020,33.023,32.025,30]tetratriaconta-1,3(16),4(13),5,11,17,19,23(32),24,30,33-undecaene-7,29-diimine (PubChem CID 5465783) has the molecular formula C40H46N6O2 and a molecular weight of 642.85 g/mol. Its IUPAC name is 12,24-dibutyl-7-N,29-N-dimethoxy-2,5,31,34-tetrazaoctacyclo[16.16.0.03,16.04,13.06,11.020,33.023,32.025,30]tetratriaconta-1,3(16),4(13),5,11,17,19,23(32),24,30,33-undecaene-7,29-diimine.
| Compound Name | 12,24-dibutyl-7-N,29-N-dimethoxy-2,5,31,34-tetrazaoctacyclo[16.16.0.03,16.04,13.06,11.020,33.023,32.025,30]tetratriaconta-1,3(16),4(13),5,11,17,19,23(32),24,30,33-undecaene-7,29-diimine |
|---|---|
| PubChem CID | 5465783 |
| Molecular Formula | C40H46N6O2 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.37 |
| IUPAC Name | 12,24-dibutyl-7-N,29-N-dimethoxy-2,5,31,34-tetrazaoctacyclo[16.16.0.03,16.04,13.06,11.020,33.023,32.025,30]tetratriaconta-1,3(16),4(13),5,11,17,19,23(32),24,30,33-undecaene-7,29-diimine |
| SMILES | CCCCc1c2c(nc3c1CCc1cc4cc5c(nc4nc1-3)-c1nc3c(c(CCCC)c1CC5)CCC/C3=N/OC)/C(=N\OC)CCC2 |
| InChI | InChI=1S/C40H46N6O2/c1-5-7-11-26-28-13-9-15-32(45-47-3)36(28)41-38-30(26)19-17-23-21-25-22-24-18-20-31-27(12-8-6-2)29-14-10-16-33(46-48-4)37(29)42-39(31)35(24)44-40(25)43-34(23)38/h21-22H,5-20H2,1-4H3/b45-32-,46-33- |
| InChIKey | YZQPPZXHJBVPPY-MCCADXDESA-N |
| XLogP | 8.01 |
| TPSA | 94.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|