About 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene
2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene (PubChem CID 546588) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene.
Analyze 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene?
The IUPAC name of 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene (CID 546588) is 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene.
What is the SMILES notation for 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene?
The canonical SMILES for 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene is CC1(C)C=CC(C(C)(C)C)=CC(C(C)(C)C)=C1.
What is the InChIKey of 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene?
The InChIKey is XRNWYQIXEQYXPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-15(2,3)13-9-10-17(7,8)12-14(11-13)16(4,5)6/h9-12H,1-8H3.
What are the key properties of 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene?
2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene has a molecular weight of 232.41 g/mol, XLogP of 5.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-7,7-dimethylcyclohepta-1,3,5-triene is sourced from PubChem (CID 546588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).