C17H16N4S — CID 5465894
4-amino-5-phenyl-6,7,8,9-tetrahydro-3H-pyrimido[4,5-b]quinoline-2-thione (PubChem CID 5465894) has the molecular formula C17H16N4S and a molecular weight of 308.41 g/mol. Its IUPAC name is 4-amino-5-phenyl-6,7,8,9-tetrahydro-3H-pyrimido[4,5-b]quinoline-2-thione.
| Compound Name | 4-amino-5-phenyl-6,7,8,9-tetrahydro-3H-pyrimido[4,5-b]quinoline-2-thione |
|---|---|
| PubChem CID | 5465894 |
| Molecular Formula | C17H16N4S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 4-amino-5-phenyl-6,7,8,9-tetrahydro-3H-pyrimido[4,5-b]quinoline-2-thione |
| SMILES | Nc1[nH]c(=S)nc2nc3c(c(-c4ccccc4)c12)CCCC3 |
| InChI | InChI=1S/C17H16N4S/c18-15-14-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)19-16(14)21-17(22)20-15/h1-3,6-7H,4-5,8-9H2,(H3,18,19,20,21,22) |
| InChIKey | KOIUJRZOOZNDRQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|