C21H26ClN3O4S — CID 54659209
2-[(3S,6aS,8S,10aS)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 54659209) has the molecular formula C21H26ClN3O4S and a molecular weight of 451.98 g/mol. Its IUPAC name is 2-[(3S,6aS,8S,10aS)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(3S,6aS,8S,10aS)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 54659209 |
| Molecular Formula | C21H26ClN3O4S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-[(3S,6aS,8S,10aS)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(C[C@@H]1CC[C@H]2[C@@H](COC[C@@H](O)CN2Cc2ccc(Cl)cc2)O1)Nc1nccs1 |
| InChI | InChI=1S/C21H26ClN3O4S/c22-15-3-1-14(2-4-15)10-25-11-16(26)12-28-13-19-18(25)6-5-17(29-19)9-20(27)24-21-23-7-8-30-21/h1-4,7-8,16-19,26H,5-6,9-13H2,(H,23,24,27)/t16-,17-,18-,19+/m0/s1 |
| InChIKey | LKFFAURRJBNZDA-CADBVGFASA-N |
| XLogP | 2.93 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |