C20H29FN2O4 — CID 54660044
2-[(3S,6aS,8R,10aS)-1-[(2-fluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-ethylacetamide (PubChem CID 54660044) has the molecular formula C20H29FN2O4 and a molecular weight of 380.46 g/mol. Its IUPAC name is 2-[(3S,6aS,8R,10aS)-1-[(2-fluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-ethylacetamide.
| Compound Name | 2-[(3S,6aS,8R,10aS)-1-[(2-fluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 54660044 |
| Molecular Formula | C20H29FN2O4 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-[(3S,6aS,8R,10aS)-1-[(2-fluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@H]1CC[C@H]2[C@@H](COC[C@@H](O)CN2Cc2ccccc2F)O1 |
| InChI | InChI=1S/C20H29FN2O4/c1-2-22-20(25)9-16-7-8-18-19(27-16)13-26-12-15(24)11-23(18)10-14-5-3-4-6-17(14)21/h3-6,15-16,18-19,24H,2,7-13H2,1H3,(H,22,25)/t15-,16+,18-,19+/m0/s1 |
| InChIKey | TXQINWPPIWDOAM-OGWHTMIXSA-N |
| XLogP | 1.46 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |