C25H28F2N2O5 — CID 54660254
2-[(3S,6aS,8R,10aS)-1-(2-fluorobenzoyl)-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 54660254) has the molecular formula C25H28F2N2O5 and a molecular weight of 474.50 g/mol. Its IUPAC name is 2-[(3S,6aS,8R,10aS)-1-(2-fluorobenzoyl)-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[(3S,6aS,8R,10aS)-1-(2-fluorobenzoyl)-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54660254 |
| Molecular Formula | C25H28F2N2O5 |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-[(3S,6aS,8R,10aS)-1-(2-fluorobenzoyl)-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(C[C@H]1CC[C@H]2[C@@H](COC[C@@H](O)CN2C(=O)c2ccccc2F)O1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H28F2N2O5/c26-17-7-5-16(6-8-17)12-28-24(31)11-19-9-10-22-23(34-19)15-33-14-18(30)13-29(22)25(32)20-3-1-2-4-21(20)27/h1-8,18-19,22-23,30H,9-15H2,(H,28,31)/t18-,19+,22-,23+/m0/s1 |
| InChIKey | NCTKGAFXJZHGHT-JFSTXAPLSA-N |
| XLogP | 2.42 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |