C27H28FN3O3 — CID 54661090
(1S,9R,10R,11R)-12-benzyl-5-(3-fluorophenyl)-10-(hydroxymethyl)-N,N-dimethyl-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide (PubChem CID 54661090) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is (1S,9R,10R,11R)-12-benzyl-5-(3-fluorophenyl)-10-(hydroxymethyl)-N,N-dimethyl-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide.
| Compound Name | (1S,9R,10R,11R)-12-benzyl-5-(3-fluorophenyl)-10-(hydroxymethyl)-N,N-dimethyl-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide |
|---|---|
| PubChem CID | 54661090 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (1S,9R,10R,11R)-12-benzyl-5-(3-fluorophenyl)-10-(hydroxymethyl)-N,N-dimethyl-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(ccc(-c4cccc(F)c4)c3=O)[C@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C27H28FN3O3/c1-29(2)27(34)24-21(16-32)23-15-31-22(25(24)30(23)14-17-7-4-3-5-8-17)12-11-20(26(31)33)18-9-6-10-19(28)13-18/h3-13,21,23-25,32H,14-16H2,1-2H3/t21-,23-,24+,25+/m0/s1 |
| InChIKey | DPECORRGLVHITO-VLYJIQRVSA-N |
| XLogP | 2.91 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |