C25H29FN2O4 — CID 54661325
methyl (1R,9S,10S,11S)-12-(cyclopentylmethyl)-5-(2-fluorophenyl)-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate (PubChem CID 54661325) has the molecular formula C25H29FN2O4 and a molecular weight of 440.52 g/mol. Its IUPAC name is methyl (1R,9S,10S,11S)-12-(cyclopentylmethyl)-5-(2-fluorophenyl)-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate.
| Compound Name | methyl (1R,9S,10S,11S)-12-(cyclopentylmethyl)-5-(2-fluorophenyl)-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate |
|---|---|
| PubChem CID | 54661325 |
| Molecular Formula | C25H29FN2O4 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | methyl (1R,9S,10S,11S)-12-(cyclopentylmethyl)-5-(2-fluorophenyl)-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](CO)[C@H]2Cn3c(ccc(-c4ccccc4F)c3=O)[C@@H]1N2CC1CCCC1 |
| InChI | InChI=1S/C25H29FN2O4/c1-32-25(31)22-18(14-29)21-13-28-20(23(22)27(21)12-15-6-2-3-7-15)11-10-17(24(28)30)16-8-4-5-9-19(16)26/h4-5,8-11,15,18,21-23,29H,2-3,6-7,12-14H2,1H3/t18-,21-,22+,23+/m1/s1 |
| InChIKey | PYNGVIMXOMYUPN-QQUTXWOLSA-N |
| XLogP | 2.98 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |