C24H28FN3O4 — CID 54661622
(1S,9R,10R,11R)-12-ethyl-5-(2-fluorophenyl)-10-(hydroxymethyl)-11-(morpholine-4-carbonyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one (PubChem CID 54661622) has the molecular formula C24H28FN3O4 and a molecular weight of 441.50 g/mol. Its IUPAC name is (1S,9R,10R,11R)-12-ethyl-5-(2-fluorophenyl)-10-(hydroxymethyl)-11-(morpholine-4-carbonyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one.
| Compound Name | (1S,9R,10R,11R)-12-ethyl-5-(2-fluorophenyl)-10-(hydroxymethyl)-11-(morpholine-4-carbonyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one |
|---|---|
| PubChem CID | 54661622 |
| Molecular Formula | C24H28FN3O4 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (1S,9R,10R,11R)-12-ethyl-5-(2-fluorophenyl)-10-(hydroxymethyl)-11-(morpholine-4-carbonyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one |
| SMILES | CCN1[C@@H]2c3ccc(-c4ccccc4F)c(=O)n3C[C@H]1[C@H](CO)[C@H]2C(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H28FN3O4/c1-2-27-20-13-28-19(8-7-16(23(28)30)15-5-3-4-6-18(15)25)22(27)21(17(20)14-29)24(31)26-9-11-32-12-10-26/h3-8,17,20-22,29H,2,9-14H2,1H3/t17-,20-,21+,22+/m0/s1 |
| InChIKey | NBHDVEBQGXPPRD-GUGJDKNPSA-N |
| XLogP | 1.50 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |