C26H26FN3O3 — CID 54661721
(2R,3R,3aS,9bS)-N-benzyl-1-[(2-fluorophenyl)methyl]-3-(hydroxymethyl)-6-oxo-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide (PubChem CID 54661721) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is (2R,3R,3aS,9bS)-N-benzyl-1-[(2-fluorophenyl)methyl]-3-(hydroxymethyl)-6-oxo-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide.
| Compound Name | (2R,3R,3aS,9bS)-N-benzyl-1-[(2-fluorophenyl)methyl]-3-(hydroxymethyl)-6-oxo-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide |
|---|---|
| PubChem CID | 54661721 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (2R,3R,3aS,9bS)-N-benzyl-1-[(2-fluorophenyl)methyl]-3-(hydroxymethyl)-6-oxo-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@H]1[C@H](CO)[C@H]2Cn3c(cccc3=O)[C@H]2N1Cc1ccccc1F |
| InChI | InChI=1S/C26H26FN3O3/c27-21-10-5-4-9-18(21)14-30-24-19(15-29-22(24)11-6-12-23(29)32)20(16-31)25(30)26(33)28-13-17-7-2-1-3-8-17/h1-12,19-20,24-25,31H,13-16H2,(H,28,33)/t19-,20-,24+,25-/m1/s1 |
| InChIKey | VJURSMOFKWISFI-KYXKYNKESA-N |
| XLogP | 2.47 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |