C19H23N3S — CID 5466196
(E)-N-[(E)-(4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene)amino]-3-methyl-1,3-benzothiazol-2-imine (PubChem CID 5466196) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is (E)-N-[(E)-(4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene)amino]-3-methyl-1,3-benzothiazol-2-imine.
| Compound Name | (E)-N-[(E)-(4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene)amino]-3-methyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 5466196 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (E)-N-[(E)-(4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene)amino]-3-methyl-1,3-benzothiazol-2-imine |
| SMILES | Cn1/c(=N\N=C2\C=C3CCCCC3(C)CC2)sc2ccccc21 |
| InChI | InChI=1S/C19H23N3S/c1-19-11-6-5-7-14(19)13-15(10-12-19)20-21-18-22(2)16-8-3-4-9-17(16)23-18/h3-4,8-9,13H,5-7,10-12H2,1-2H3/b20-15+,21-18+ |
| InChIKey | IUZHEHZKBGVLLY-XMUCCTBASA-N |
| XLogP | 4.80 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|