C21H21FN2O5 — CID 54663009
methyl (1S,9R,10R,11R)-12-acetyl-5-(4-fluorophenyl)-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate (PubChem CID 54663009) has the molecular formula C21H21FN2O5 and a molecular weight of 400.41 g/mol. Its IUPAC name is methyl (1S,9R,10R,11R)-12-acetyl-5-(4-fluorophenyl)-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate.
| Compound Name | methyl (1S,9R,10R,11R)-12-acetyl-5-(4-fluorophenyl)-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate |
|---|---|
| PubChem CID | 54663009 |
| Molecular Formula | C21H21FN2O5 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | methyl (1S,9R,10R,11R)-12-acetyl-5-(4-fluorophenyl)-10-(hydroxymethyl)-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(ccc(-c4ccc(F)cc4)c3=O)[C@H]1N2C(C)=O |
| InChI | InChI=1S/C21H21FN2O5/c1-11(26)24-17-9-23-16(19(24)18(15(17)10-25)21(28)29-2)8-7-14(20(23)27)12-3-5-13(22)6-4-12/h3-8,15,17-19,25H,9-10H2,1-2H3/t15-,17-,18+,19+/m0/s1 |
| InChIKey | SBNCLXQUCRMFFX-GDAAHCPNSA-N |
| XLogP | 1.34 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |