About tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate
tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate (PubChem CID 546635) has the molecular formula C9H15Br2NO2
and a molecular weight of 329.03 g/mol. Its IUPAC name is tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate |
| PubChem CID | 546635 |
| Molecular Formula | C9H15Br2NO2 |
| Molecular Weight | 329.03 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate |
| SMILES | CC(C=C(Br)Br)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H15Br2NO2/c1-6(5-7(10)11)12-8(13)14-9(2,3)4/h5-6H,1-4H3,(H,12,13) |
| InChIKey | MSKJXHWGOZROHF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.03 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate?
The IUPAC name of tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate (CID 546635) is tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate.
What is the SMILES notation for tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate?
The canonical SMILES for tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate is CC(C=C(Br)Br)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate?
The InChIKey is MSKJXHWGOZROHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15Br2NO2/c1-6(5-7(10)11)12-8(13)14-9(2,3)4/h5-6H,1-4H3,(H,12,13).
What are the key properties of tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate?
tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate has a molecular weight of 329.03 g/mol, XLogP of 3.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(4,4-dibromobut-3-en-2-yl)carbamate is sourced from PubChem (CID 546635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).