About 1-oxo-1λ4,2-benzodithiol-3-one
1-oxo-1λ4,2-benzodithiol-3-one (PubChem CID 5466364) has the molecular formula C7H4O2S2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-oxo-1λ4,2-benzodithiol-3-one.
Molecular Properties
| Compound Name | 1-oxo-1λ4,2-benzodithiol-3-one |
| PubChem CID | 5466364 |
| Molecular Formula | C7H4O2S2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 183.97 |
| IUPAC Name | 1-oxo-1λ4,2-benzodithiol-3-one |
| SMILES | O=C1SS(=O)c2ccccc21 |
| InChI | InChI=1S/C7H4O2S2/c8-7-5-3-1-2-4-6(5)11(9)10-7/h1-4H |
| InChIKey | RFKVIOFDUHRMTD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-oxo-1λ4,2-benzodithiol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-1λ4,2-benzodithiol-3-one?
The IUPAC name of 1-oxo-1λ4,2-benzodithiol-3-one (CID 5466364) is 1-oxo-1λ4,2-benzodithiol-3-one.
What is the SMILES notation for 1-oxo-1λ4,2-benzodithiol-3-one?
The canonical SMILES for 1-oxo-1λ4,2-benzodithiol-3-one is O=C1SS(=O)c2ccccc21.
What is the InChIKey of 1-oxo-1λ4,2-benzodithiol-3-one?
The InChIKey is RFKVIOFDUHRMTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O2S2/c8-7-5-3-1-2-4-6(5)11(9)10-7/h1-4H.
What are the key properties of 1-oxo-1λ4,2-benzodithiol-3-one?
1-oxo-1λ4,2-benzodithiol-3-one has a molecular weight of 184.24 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-1λ4,2-benzodithiol-3-one is sourced from PubChem (CID 5466364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).