C30H28N4O3 — CID 54663704
(1R,9S,10S,11S)-10-(hydroxymethyl)-6-oxo-N-(4-phenylphenyl)-12-(pyridin-3-ylmethyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide (PubChem CID 54663704) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is (1R,9S,10S,11S)-10-(hydroxymethyl)-6-oxo-N-(4-phenylphenyl)-12-(pyridin-3-ylmethyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide.
| Compound Name | (1R,9S,10S,11S)-10-(hydroxymethyl)-6-oxo-N-(4-phenylphenyl)-12-(pyridin-3-ylmethyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide |
|---|---|
| PubChem CID | 54663704 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (1R,9S,10S,11S)-10-(hydroxymethyl)-6-oxo-N-(4-phenylphenyl)-12-(pyridin-3-ylmethyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)[C@H]1[C@H](CO)[C@H]2Cn3c(cccc3=O)[C@@H]1N2Cc1cccnc1 |
| InChI | InChI=1S/C30H28N4O3/c35-19-24-26-18-33-25(9-4-10-27(33)36)29(34(26)17-20-6-5-15-31-16-20)28(24)30(37)32-23-13-11-22(12-14-23)21-7-2-1-3-8-21/h1-16,24,26,28-29,35H,17-19H2,(H,32,37)/t24-,26-,28+,29+/m1/s1 |
| InChIKey | TUPKZYNLOFBIBQ-DOYJQPJHSA-N |
| XLogP | 3.71 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |