C25H26N6O4 — CID 54664062
(1S,9R,10R,11R)-11-N-ethyl-10-(hydroxymethyl)-6-oxo-12-N-phenyl-5-pyrimidin-5-yl-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11,12-dicarboxamide (PubChem CID 54664062) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is (1S,9R,10R,11R)-11-N-ethyl-10-(hydroxymethyl)-6-oxo-12-N-phenyl-5-pyrimidin-5-yl-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11,12-dicarboxamide.
| Compound Name | (1S,9R,10R,11R)-11-N-ethyl-10-(hydroxymethyl)-6-oxo-12-N-phenyl-5-pyrimidin-5-yl-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11,12-dicarboxamide |
|---|---|
| PubChem CID | 54664062 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (1S,9R,10R,11R)-11-N-ethyl-10-(hydroxymethyl)-6-oxo-12-N-phenyl-5-pyrimidin-5-yl-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11,12-dicarboxamide |
| SMILES | CCNC(=O)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(ccc(-c4cncnc4)c3=O)[C@H]1N2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H26N6O4/c1-2-28-23(33)21-18(13-32)20-12-30-19(9-8-17(24(30)34)15-10-26-14-27-11-15)22(21)31(20)25(35)29-16-6-4-3-5-7-16/h3-11,14,18,20-22,32H,2,12-13H2,1H3,(H,28,33)(H,29,35)/t18-,20-,21+,22+/m0/s1 |
| InChIKey | QUWXEMFKKRLVKW-VXSCBNMQSA-N |
| XLogP | 1.64 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |