C31H29N3O3 — CID 54664144
(1R,9S,10S,11S)-12-benzyl-10-(hydroxymethyl)-6-oxo-N-(4-phenylphenyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide (PubChem CID 54664144) has the molecular formula C31H29N3O3 and a molecular weight of 491.59 g/mol. Its IUPAC name is (1R,9S,10S,11S)-12-benzyl-10-(hydroxymethyl)-6-oxo-N-(4-phenylphenyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide.
| Compound Name | (1R,9S,10S,11S)-12-benzyl-10-(hydroxymethyl)-6-oxo-N-(4-phenylphenyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide |
|---|---|
| PubChem CID | 54664144 |
| Molecular Formula | C31H29N3O3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (1R,9S,10S,11S)-12-benzyl-10-(hydroxymethyl)-6-oxo-N-(4-phenylphenyl)-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)[C@H]1[C@H](CO)[C@H]2Cn3c(cccc3=O)[C@@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C31H29N3O3/c35-20-25-27-19-33-26(12-7-13-28(33)36)30(34(27)18-21-8-3-1-4-9-21)29(25)31(37)32-24-16-14-23(15-17-24)22-10-5-2-6-11-22/h1-17,25,27,29-30,35H,18-20H2,(H,32,37)/t25-,27-,29+,30+/m1/s1 |
| InChIKey | SCMOCKWDZOFMAR-OKYDJYPCSA-N |
| XLogP | 4.32 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |