C26H28N2O5 — CID 54664604
methyl (1R,9S,10S,11S)-12-(cyclobutanecarbonyl)-10-(hydroxymethyl)-6-oxo-5-[(E)-2-phenylethenyl]-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate (PubChem CID 54664604) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is methyl (1R,9S,10S,11S)-12-(cyclobutanecarbonyl)-10-(hydroxymethyl)-6-oxo-5-[(E)-2-phenylethenyl]-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate.
| Compound Name | methyl (1R,9S,10S,11S)-12-(cyclobutanecarbonyl)-10-(hydroxymethyl)-6-oxo-5-[(E)-2-phenylethenyl]-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate |
|---|---|
| PubChem CID | 54664604 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | methyl (1R,9S,10S,11S)-12-(cyclobutanecarbonyl)-10-(hydroxymethyl)-6-oxo-5-[(E)-2-phenylethenyl]-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](CO)[C@H]2Cn3c(ccc(/C=C/c4ccccc4)c3=O)[C@@H]1N2C(=O)C1CCC1 |
| InChI | InChI=1S/C26H28N2O5/c1-33-26(32)22-19(15-29)21-14-27-20(23(22)28(21)25(31)17-8-5-9-17)13-12-18(24(27)30)11-10-16-6-3-2-4-7-16/h2-4,6-7,10-13,17,19,21-23,29H,5,8-9,14-15H2,1H3/b11-10+/t19-,21-,22+,23+/m1/s1 |
| InChIKey | RYCMYVQDTJVJFE-TWSJCRGDSA-N |
| XLogP | 2.48 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |