C25H30FN3O3 — CID 54664760
(2S,3S,3aR,9bR)-N-cyclohexyl-7-(3-fluorophenyl)-3-(hydroxymethyl)-1-methyl-6-oxo-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide (PubChem CID 54664760) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is (2S,3S,3aR,9bR)-N-cyclohexyl-7-(3-fluorophenyl)-3-(hydroxymethyl)-1-methyl-6-oxo-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide.
| Compound Name | (2S,3S,3aR,9bR)-N-cyclohexyl-7-(3-fluorophenyl)-3-(hydroxymethyl)-1-methyl-6-oxo-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide |
|---|---|
| PubChem CID | 54664760 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (2S,3S,3aR,9bR)-N-cyclohexyl-7-(3-fluorophenyl)-3-(hydroxymethyl)-1-methyl-6-oxo-3,3a,4,9b-tetrahydro-2H-pyrrolo[2,3-a]indolizine-2-carboxamide |
| SMILES | CN1[C@H](C(=O)NC2CCCCC2)[C@@H](CO)[C@@H]2Cn3c(ccc(-c4cccc(F)c4)c3=O)[C@@H]21 |
| InChI | InChI=1S/C25H30FN3O3/c1-28-22-19(20(14-30)23(28)24(31)27-17-8-3-2-4-9-17)13-29-21(22)11-10-18(25(29)32)15-6-5-7-16(26)12-15/h5-7,10-12,17,19-20,22-23,30H,2-4,8-9,13-14H2,1H3,(H,27,31)/t19-,20-,22+,23-/m0/s1 |
| InChIKey | DLYLXSSGAFZZRX-RLBLXZPPSA-N |
| XLogP | 2.70 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |