C13H17BrN2O — CID 54664796
[(3aR,4S,9bS)-8-bromo-5-methyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54664796) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is [(3aR,4S,9bS)-8-bromo-5-methyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aR,4S,9bS)-8-bromo-5-methyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54664796 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | [(3aR,4S,9bS)-8-bromo-5-methyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | CN1c2ccc(Br)cc2[C@H]2NCC[C@H]2[C@H]1CO |
| InChI | InChI=1S/C13H17BrN2O/c1-16-11-3-2-8(14)6-10(11)13-9(4-5-15-13)12(16)7-17/h2-3,6,9,12-13,15,17H,4-5,7H2,1H3/t9-,12+,13-/m0/s1 |
| InChIKey | WZXLZJWWSUUIOX-BIMULSAOSA-N |
| XLogP | 1.91 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |