C21H23BrN2O2 — CID 54665010
1-[(3aS,4S,9bR)-8-bromo-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone (PubChem CID 54665010) has the molecular formula C21H23BrN2O2 and a molecular weight of 415.33 g/mol. Its IUPAC name is 1-[(3aS,4S,9bR)-8-bromo-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone.
| Compound Name | 1-[(3aS,4S,9bR)-8-bromo-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 54665010 |
| Molecular Formula | C21H23BrN2O2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 1-[(3aS,4S,9bR)-8-bromo-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone |
| SMILES | CN1c2ccc(Br)cc2[C@H]2[C@H](CCN2C(=O)Cc2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C21H23BrN2O2/c1-23-18-8-7-15(22)12-17(18)21-16(19(23)13-25)9-10-24(21)20(26)11-14-5-3-2-4-6-14/h2-8,12,16,19,21,25H,9-11,13H2,1H3/t16-,19-,21-/m1/s1 |
| InChIKey | CDWQQECEQQYKFS-OZOXKJRCSA-N |
| XLogP | 3.39 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |