C26H24F2N2O2 — CID 54665037
[(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 54665037) has the molecular formula C26H24F2N2O2 and a molecular weight of 434.49 g/mol. Its IUPAC name is [(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 54665037 |
| Molecular Formula | C26H24F2N2O2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | CN1c2ccc(-c3cccc(F)c3)cc2[C@H]2[C@H](CCN2C(=O)c2ccccc2F)[C@H]1CO |
| InChI | InChI=1S/C26H24F2N2O2/c1-29-23-10-9-17(16-5-4-6-18(27)13-16)14-21(23)25-20(24(29)15-31)11-12-30(25)26(32)19-7-2-3-8-22(19)28/h2-10,13-14,20,24-25,31H,11-12,15H2,1H3/t20-,24-,25-/m1/s1 |
| InChIKey | GKEXEEJLCYEBRL-NIJXNBFTSA-N |
| XLogP | 4.65 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |