C26H27FN2O2 — CID 54665142
[(3aR,4S,9bR)-8-(3-fluorophenyl)-1-[(2-methoxyphenyl)methyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54665142) has the molecular formula C26H27FN2O2 and a molecular weight of 418.51 g/mol. Its IUPAC name is [(3aR,4S,9bR)-8-(3-fluorophenyl)-1-[(2-methoxyphenyl)methyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aR,4S,9bR)-8-(3-fluorophenyl)-1-[(2-methoxyphenyl)methyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54665142 |
| Molecular Formula | C26H27FN2O2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [(3aR,4S,9bR)-8-(3-fluorophenyl)-1-[(2-methoxyphenyl)methyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | COc1ccccc1CN1CC[C@@H]2[C@@H](CO)Nc3ccc(-c4cccc(F)c4)cc3[C@@H]21 |
| InChI | InChI=1S/C26H27FN2O2/c1-31-25-8-3-2-5-19(25)15-29-12-11-21-24(16-30)28-23-10-9-18(14-22(23)26(21)29)17-6-4-7-20(27)13-17/h2-10,13-14,21,24,26,28,30H,11-12,15-16H2,1H3/t21-,24-,26-/m1/s1 |
| InChIKey | LQFBZQYXVHLUGY-YMVVMYQSSA-N |
| XLogP | 4.85 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |