C25H24F2N2O — CID 54665172
[(3aS,4R,9bS)-8-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54665172) has the molecular formula C25H24F2N2O and a molecular weight of 406.48 g/mol. Its IUPAC name is [(3aS,4R,9bS)-8-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aS,4R,9bS)-8-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54665172 |
| Molecular Formula | C25H24F2N2O |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [(3aS,4R,9bS)-8-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | OC[C@@H]1Nc2ccc(-c3ccc(F)cc3)cc2[C@@H]2[C@H]1CCN2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H24F2N2O/c26-19-6-1-16(2-7-19)14-29-12-11-21-24(15-30)28-23-10-5-18(13-22(23)25(21)29)17-3-8-20(27)9-4-17/h1-10,13,21,24-25,28,30H,11-12,14-15H2/t21-,24-,25-/m0/s1 |
| InChIKey | KHZFHAVWRUEQAM-TUSQITKMSA-N |
| XLogP | 4.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |