C25H27FN2O2 — CID 54665254
[(3aS,4S,9bS)-8-(cyclohexen-1-yl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 54665254) has the molecular formula C25H27FN2O2 and a molecular weight of 406.50 g/mol. Its IUPAC name is [(3aS,4S,9bS)-8-(cyclohexen-1-yl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(3aS,4S,9bS)-8-(cyclohexen-1-yl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 54665254 |
| Molecular Formula | C25H27FN2O2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [(3aS,4S,9bS)-8-(cyclohexen-1-yl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CC[C@@H]2[C@H]1c1cc(C3=CCCCC3)ccc1N[C@@H]2CO |
| InChI | InChI=1S/C25H27FN2O2/c26-19-9-6-17(7-10-19)25(30)28-13-12-20-23(15-29)27-22-11-8-18(14-21(22)24(20)28)16-4-2-1-3-5-16/h4,6-11,14,20,23-24,27,29H,1-3,5,12-13,15H2/t20-,23+,24-/m0/s1 |
| InChIKey | MSZBCWXCLRULJJ-ZTCOLXNVSA-N |
| XLogP | 4.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |