C25H25FN2O3S — CID 54665297
[(3aR,4S,9bR)-8-(4-fluorophenyl)-1-(2-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54665297) has the molecular formula C25H25FN2O3S and a molecular weight of 452.55 g/mol. Its IUPAC name is [(3aR,4S,9bR)-8-(4-fluorophenyl)-1-(2-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aR,4S,9bR)-8-(4-fluorophenyl)-1-(2-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54665297 |
| Molecular Formula | C25H25FN2O3S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [(3aR,4S,9bR)-8-(4-fluorophenyl)-1-(2-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | Cc1ccccc1S(=O)(=O)N1CC[C@@H]2[C@@H](CO)Nc3ccc(-c4ccc(F)cc4)cc3[C@@H]21 |
| InChI | InChI=1S/C25H25FN2O3S/c1-16-4-2-3-5-24(16)32(30,31)28-13-12-20-23(15-29)27-22-11-8-18(14-21(22)25(20)28)17-6-9-19(26)10-7-17/h2-11,14,20,23,25,27,29H,12-13,15H2,1H3/t20-,23-,25-/m1/s1 |
| InChIKey | SNNGQIWZJPTSCI-QFZRFWILSA-N |
| XLogP | 4.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |