C22H25FN2O2 — CID 54665306
1-[(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]propan-1-one (PubChem CID 54665306) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is 1-[(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]propan-1-one.
| Compound Name | 1-[(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 54665306 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-[(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CC[C@@H]2[C@@H](CO)N(C)c3ccc(-c4cccc(F)c4)cc3[C@@H]21 |
| InChI | InChI=1S/C22H25FN2O2/c1-3-21(27)25-10-9-17-20(13-26)24(2)19-8-7-15(12-18(19)22(17)25)14-5-4-6-16(23)11-14/h4-8,11-12,17,20,22,26H,3,9-10,13H2,1-2H3/t17-,20-,22-/m1/s1 |
| InChIKey | SFMKYQRQRSGMSM-NQSCKRDGSA-N |
| XLogP | 3.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |