C25H31N3O2 — CID 54665474
(3aR,4S,9bS)-N-cyclopentyl-4-(hydroxymethyl)-5-methyl-8-phenyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide (PubChem CID 54665474) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (3aR,4S,9bS)-N-cyclopentyl-4-(hydroxymethyl)-5-methyl-8-phenyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide.
| Compound Name | (3aR,4S,9bS)-N-cyclopentyl-4-(hydroxymethyl)-5-methyl-8-phenyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 54665474 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (3aR,4S,9bS)-N-cyclopentyl-4-(hydroxymethyl)-5-methyl-8-phenyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
| SMILES | CN1c2ccc(-c3ccccc3)cc2[C@@H]2[C@@H](CCN2C(=O)NC2CCCC2)[C@H]1CO |
| InChI | InChI=1S/C25H31N3O2/c1-27-22-12-11-18(17-7-3-2-4-8-17)15-21(22)24-20(23(27)16-29)13-14-28(24)25(30)26-19-9-5-6-10-19/h2-4,7-8,11-12,15,19-20,23-24,29H,5-6,9-10,13-14,16H2,1H3,(H,26,30)/t20-,23+,24-/m0/s1 |
| InChIKey | VPPSXNQJMZMNKY-ZTCOLXNVSA-N |
| XLogP | 4.18 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |