C24H27FN2O3S — CID 54665605
[(3aR,4S,9bR)-8-(cyclohexen-1-yl)-1-(2-fluorophenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54665605) has the molecular formula C24H27FN2O3S and a molecular weight of 442.56 g/mol. Its IUPAC name is [(3aR,4S,9bR)-8-(cyclohexen-1-yl)-1-(2-fluorophenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aR,4S,9bR)-8-(cyclohexen-1-yl)-1-(2-fluorophenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54665605 |
| Molecular Formula | C24H27FN2O3S |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [(3aR,4S,9bR)-8-(cyclohexen-1-yl)-1-(2-fluorophenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | O=S(=O)(c1ccccc1F)N1CC[C@@H]2[C@@H](CO)Nc3ccc(C4=CCCCC4)cc3[C@@H]21 |
| InChI | InChI=1S/C24H27FN2O3S/c25-20-8-4-5-9-23(20)31(29,30)27-13-12-18-22(15-28)26-21-11-10-17(14-19(21)24(18)27)16-6-2-1-3-7-16/h4-6,8-11,14,18,22,24,26,28H,1-3,7,12-13,15H2/t18-,22-,24-/m1/s1 |
| InChIKey | OISKMIDGBWGEMM-IHLLOCCUSA-N |
| XLogP | 4.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |