C20H21BrN2O2 — CID 54665616
1-[(3aS,4S,9bS)-8-bromo-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone (PubChem CID 54665616) has the molecular formula C20H21BrN2O2 and a molecular weight of 401.30 g/mol. Its IUPAC name is 1-[(3aS,4S,9bS)-8-bromo-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone.
| Compound Name | 1-[(3aS,4S,9bS)-8-bromo-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 54665616 |
| Molecular Formula | C20H21BrN2O2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 1-[(3aS,4S,9bS)-8-bromo-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CC[C@@H]2[C@H]1c1cc(Br)ccc1N[C@@H]2CO |
| InChI | InChI=1S/C20H21BrN2O2/c21-14-6-7-17-16(11-14)20-15(18(12-24)22-17)8-9-23(20)19(25)10-13-4-2-1-3-5-13/h1-7,11,15,18,20,22,24H,8-10,12H2/t15-,18+,20-/m0/s1 |
| InChIKey | ARPOMSMERXNOMB-CVAIRZPRSA-N |
| XLogP | 3.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |