C27H30N2O5S — CID 54665705
[(3aR,4S,9bR)-8-(3-methoxyphenyl)-1-(2-methoxyphenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54665705) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is [(3aR,4S,9bR)-8-(3-methoxyphenyl)-1-(2-methoxyphenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aR,4S,9bR)-8-(3-methoxyphenyl)-1-(2-methoxyphenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54665705 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [(3aR,4S,9bR)-8-(3-methoxyphenyl)-1-(2-methoxyphenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | COc1cccc(-c2ccc3c(c2)[C@H]2[C@H](CCN2S(=O)(=O)c2ccccc2OC)[C@@H](CO)N3C)c1 |
| InChI | InChI=1S/C27H30N2O5S/c1-28-23-12-11-19(18-7-6-8-20(15-18)33-2)16-22(23)27-21(24(28)17-30)13-14-29(27)35(31,32)26-10-5-4-9-25(26)34-3/h4-12,15-16,21,24,27,30H,13-14,17H2,1-3H3/t21-,24-,27-/m1/s1 |
| InChIKey | IZBKIWUTGPYNIA-GNMGOMLTSA-N |
| XLogP | 3.93 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |