C24H28N2O2 — CID 54665731
1-[(3aS,4R,9bR)-4-(hydroxymethyl)-5-methyl-8-phenyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-cyclopropylethanone (PubChem CID 54665731) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-[(3aS,4R,9bR)-4-(hydroxymethyl)-5-methyl-8-phenyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-cyclopropylethanone.
| Compound Name | 1-[(3aS,4R,9bR)-4-(hydroxymethyl)-5-methyl-8-phenyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 54665731 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-[(3aS,4R,9bR)-4-(hydroxymethyl)-5-methyl-8-phenyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-cyclopropylethanone |
| SMILES | CN1c2ccc(-c3ccccc3)cc2[C@H]2[C@H](CCN2C(=O)CC2CC2)[C@@H]1CO |
| InChI | InChI=1S/C24H28N2O2/c1-25-21-10-9-18(17-5-3-2-4-6-17)14-20(21)24-19(22(25)15-27)11-12-26(24)23(28)13-16-7-8-16/h2-6,9-10,14,16,19,22,24,27H,7-8,11-13,15H2,1H3/t19-,22+,24-/m1/s1 |
| InChIKey | GFRQGTPZBXCCGM-WNOPAQSVSA-N |
| XLogP | 3.85 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |