C19H26O5 — CID 5466577
ethyl 2-[(1E,3E)-5-ethoxy-3-methyl-5-oxopenta-1,3-dienyl]-1,3-dimethyl-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 5466577) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is ethyl 2-[(1E,3E)-5-ethoxy-3-methyl-5-oxopenta-1,3-dienyl]-1,3-dimethyl-4-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl 2-[(1E,3E)-5-ethoxy-3-methyl-5-oxopenta-1,3-dienyl]-1,3-dimethyl-4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 5466577 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | ethyl 2-[(1E,3E)-5-ethoxy-3-methyl-5-oxopenta-1,3-dienyl]-1,3-dimethyl-4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C1=C(C)C(=O)CCC1(C)C(=O)OCC |
| InChI | InChI=1S/C19H26O5/c1-6-23-17(21)12-13(3)8-9-15-14(4)16(20)10-11-19(15,5)18(22)24-7-2/h8-9,12H,6-7,10-11H2,1-5H3/b9-8+,13-12+ |
| InChIKey | LJFKVEUPUJOZIB-AFAJWACHSA-N |
| XLogP | 3.30 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|