C26H25F2N3O2 — CID 54665887
(3aR,4R,9bS)-8-(2-fluorophenyl)-N-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide (PubChem CID 54665887) has the molecular formula C26H25F2N3O2 and a molecular weight of 449.50 g/mol. Its IUPAC name is (3aR,4R,9bS)-8-(2-fluorophenyl)-N-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide.
| Compound Name | (3aR,4R,9bS)-8-(2-fluorophenyl)-N-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 54665887 |
| Molecular Formula | C26H25F2N3O2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (3aR,4R,9bS)-8-(2-fluorophenyl)-N-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
| SMILES | CN1c2ccc(-c3ccccc3F)cc2[C@@H]2[C@@H](CCN2C(=O)Nc2ccc(F)cc2)[C@@H]1CO |
| InChI | InChI=1S/C26H25F2N3O2/c1-30-23-11-6-16(19-4-2-3-5-22(19)28)14-21(23)25-20(24(30)15-32)12-13-31(25)26(33)29-18-9-7-17(27)8-10-18/h2-11,14,20,24-25,32H,12-13,15H2,1H3,(H,29,33)/t20-,24-,25-/m0/s1 |
| InChIKey | HXSDPFUHIHZKJD-OPXMRZJTSA-N |
| XLogP | 5.04 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |