About (Z)-1,1-dimethoxyoctadec-9-ene
(Z)-1,1-dimethoxyoctadec-9-ene (PubChem CID 5466600) has the molecular formula C20H40O2
and a molecular weight of 312.54 g/mol. Its IUPAC name is (Z)-1,1-dimethoxyoctadec-9-ene.
Molecular Properties
| Compound Name | (Z)-1,1-dimethoxyoctadec-9-ene |
| PubChem CID | 5466600 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | (Z)-1,1-dimethoxyoctadec-9-ene |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(OC)OC |
| InChI | InChI=1S/C20H40O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21-2)22-3/h11-12,20H,4-10,13-19H2,1-3H3/b12-11- |
| InChIKey | WBNMCUYSZJIEFY-QXMHVHEDSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,1-dimethoxyoctadec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1-dimethoxyoctadec-9-ene?
The IUPAC name of (Z)-1,1-dimethoxyoctadec-9-ene (CID 5466600) is (Z)-1,1-dimethoxyoctadec-9-ene.
What is the SMILES notation for (Z)-1,1-dimethoxyoctadec-9-ene?
The canonical SMILES for (Z)-1,1-dimethoxyoctadec-9-ene is CCCCCCCC/C=C\CCCCCCCC(OC)OC.
What is the InChIKey of (Z)-1,1-dimethoxyoctadec-9-ene?
The InChIKey is WBNMCUYSZJIEFY-QXMHVHEDSA-N. The full InChI is InChI=1S/C20H40O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21-2)22-3/h11-12,20H,4-10,13-19H2,1-3H3/b12-11-.
What are the key properties of (Z)-1,1-dimethoxyoctadec-9-ene?
(Z)-1,1-dimethoxyoctadec-9-ene has a molecular weight of 312.54 g/mol, XLogP of 6.64, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1-dimethoxyoctadec-9-ene is sourced from PubChem (CID 5466600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).