C23H25FN2O2 — CID 54666302
[(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-cyclopropylmethanone (PubChem CID 54666302) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is [(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-cyclopropylmethanone.
| Compound Name | [(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 54666302 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-cyclopropylmethanone |
| SMILES | CN1c2ccc(-c3cccc(F)c3)cc2[C@H]2[C@H](CCN2C(=O)C2CC2)[C@H]1CO |
| InChI | InChI=1S/C23H25FN2O2/c1-25-20-8-7-16(15-3-2-4-17(24)11-15)12-19(20)22-18(21(25)13-27)9-10-26(22)23(28)14-5-6-14/h2-4,7-8,11-12,14,18,21-22,27H,5-6,9-10,13H2,1H3/t18-,21-,22-/m1/s1 |
| InChIKey | OFEWPKJJDNBDTR-STZQEDGTSA-N |
| XLogP | 3.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |