About 2-Bromo-2-butenoic acid ethyl ester
2-Bromo-2-butenoic acid ethyl ester (PubChem CID 5466635) has the molecular formula C6H9BrO2
and a molecular weight of 193.04 g/mol. Its IUPAC name is ethyl (Z)-2-bromobut-2-enoate.
Molecular Properties
| Compound Name | 2-Bromo-2-butenoic acid ethyl ester |
| PubChem CID | 5466635 |
| Molecular Formula | C6H9BrO2 |
| Molecular Weight | 193.04 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | ethyl (Z)-2-bromobut-2-enoate |
| SMILES | CCOC(=O)/C(=C/C)/Br |
| InChI | InChI=1S/C6H9BrO2/c1-3-5(7)6(8)9-4-2/h3H,4H2,1-2H3/b5-3- |
| InChIKey | YHGVZVYRHWZVKI-HYXAFXHYSA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | 129 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.04 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-Bromo-2-butenoic acid ethyl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Bromo-2-butenoic acid ethyl ester?
The IUPAC name of 2-Bromo-2-butenoic acid ethyl ester (CID 5466635) is ethyl (Z)-2-bromobut-2-enoate.
What is the SMILES notation for 2-Bromo-2-butenoic acid ethyl ester?
The canonical SMILES for 2-Bromo-2-butenoic acid ethyl ester is CCOC(=O)/C(=C/C)/Br.
What is the InChIKey of 2-Bromo-2-butenoic acid ethyl ester?
The InChIKey is YHGVZVYRHWZVKI-HYXAFXHYSA-N. The full InChI is InChI=1S/C6H9BrO2/c1-3-5(7)6(8)9-4-2/h3H,4H2,1-2H3/b5-3-.
What are the key properties of 2-Bromo-2-butenoic acid ethyl ester?
2-Bromo-2-butenoic acid ethyl ester has a molecular weight of 193.04 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Bromo-2-butenoic acid ethyl ester is sourced from PubChem (CID 5466635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).