C31H25N3OS — CID 5466653
(2E,4E)-1-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-4-methyl-5-phenylpenta-2,4-dien-1-one (PubChem CID 5466653) has the molecular formula C31H25N3OS and a molecular weight of 487.63 g/mol. Its IUPAC name is (2E,4E)-1-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-4-methyl-5-phenylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-4-methyl-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 5466653 |
| Molecular Formula | C31H25N3OS |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (2E,4E)-1-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-4-methyl-5-phenylpenta-2,4-dien-1-one |
| SMILES | CC(/C=C/C(=O)c1sc(-n2nc(-c3ccccc3)cc2-c2ccccc2)nc1C)=C\c1ccccc1 |
| InChI | InChI=1S/C31H25N3OS/c1-22(20-24-12-6-3-7-13-24)18-19-29(35)30-23(2)32-31(36-30)34-28(26-16-10-5-11-17-26)21-27(33-34)25-14-8-4-9-15-25/h3-21H,1-2H3/b19-18+,22-20+ |
| InChIKey | FGKMUICUBCAKMJ-RFBAJPLNSA-N |
| XLogP | 7.81 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|