C24H28F4N2O — CID 54666735
[(8R,9S,10R)-9-[4-(3-fluorophenyl)phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 54666735) has the molecular formula C24H28F4N2O and a molecular weight of 436.49 g/mol. Its IUPAC name is [(8R,9S,10R)-9-[4-(3-fluorophenyl)phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8R,9S,10R)-9-[4-(3-fluorophenyl)phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 54666735 |
| Molecular Formula | C24H28F4N2O |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [(8R,9S,10R)-9-[4-(3-fluorophenyl)phenyl]-6-(3,3,3-trifluoropropyl)-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | OC[C@H]1[C@@H](c2ccc(-c3cccc(F)c3)cc2)[C@@H]2CN(CCC(F)(F)F)CCCCN12 |
| InChI | InChI=1S/C24H28F4N2O/c25-20-5-3-4-19(14-20)17-6-8-18(9-7-17)23-21-15-29(13-10-24(26,27)28)11-1-2-12-30(21)22(23)16-31/h3-9,14,21-23,31H,1-2,10-13,15-16H2/t21-,22-,23-/m0/s1 |
| InChIKey | UUQMKBIMCFDWCV-VABKMULXSA-N |
| XLogP | 4.67 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |