About (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one
(Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one (PubChem CID 5466801) has the molecular formula C21H15ClO
and a molecular weight of 318.80 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one |
| PubChem CID | 5466801 |
| Molecular Formula | C21H15ClO |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(=C\c1ccc(Cl)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15ClO/c22-19-13-11-16(12-14-19)15-20(17-7-3-1-4-8-17)21(23)18-9-5-2-6-10-18/h1-15H/b20-15- |
| InChIKey | CFOUQRQVAWHVTI-HKWRFOASSA-N |
| XLogP | 5.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one?
The IUPAC name of (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one (CID 5466801) is (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one.
What is the SMILES notation for (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one?
The canonical SMILES for (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one is O=C(/C(=C\c1ccc(Cl)cc1)c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one?
The InChIKey is CFOUQRQVAWHVTI-HKWRFOASSA-N. The full InChI is InChI=1S/C21H15ClO/c22-19-13-11-16(12-14-19)15-20(17-7-3-1-4-8-17)21(23)18-9-5-2-6-10-18/h1-15H/b20-15-.
What are the key properties of (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one?
(Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one has a molecular weight of 318.80 g/mol, XLogP of 5.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(4-chlorophenyl)-1,2-diphenylprop-2-en-1-one is sourced from PubChem (CID 5466801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).